Amprenavir D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03173 |
| Alternative Name(s) | 141W94-d4; KVX-478-d4; Agenerase-d4; Prozei-d4; |
| Research Area | Labelled Amprenavir, a selective HIV protease inhibitor. An analogue of Ritonavir.;Labeled Amprenavir, intended for use as an internal standard for the quantification of Amprenavir by GC- or LC-mass spectrometry. |
| Molecular Formula | C25H31D4N3O6S |
| CAS# | 1217661-20-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[S](N(CC(C)C)C[C@@H](O)[C@@H](NC(O[C@H]1CC([2H])([2H])OC1([2H])[2H])=O)CC2=CC=CC=C2)(C3=CC=C(N)C=C3)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03173.html |
| Additional Information | NULL |