n-Butylbenzene D14
Deuterated Building Blocks
| Trivial name | NULL |
| Catalog Number | CS-O-15387 |
| Alternative Name(s) | n-Butylbenzene-d14;1-(D9)butyl(D5)benzene. |
| Research Area | Labeled Butylbenzene , intended for use as an internal standard for the quantification of Butylbenzene by GC- or LC-mass spectrometry. |
| Molecular Formula | C10D14 |
| CAS# | 634897-78-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [2H]C(C(C([2H])=C1[2H])=C(C([2H])=C1[2H])[2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO15387.html |
| Additional Information | NULL |