Dihydronarwedine
Metabolites
| Trivial name | NULL |
| Catalog Number | CS-O-11259 |
| Alternative Name(s) | (-)-Dihydrogalanthaminone;(4aS,8aR)-4a,5,7,8,9,10,11,12-Octahydro-3-methoxy-11-methyl-6H-benzofuro[3a,3,2-ef][2]benzazepin-6-one |
| Research Area | Dihydronarwedine is a metabolite of Galanthamine , a selective acetylcholinesterase inhibitor and therapeutic agent for the treatment and prevention of Alzheimer's disease and disorders resulting from reduced neuronal metabolism. |
| Molecular Formula | C17H21NO3 |
| CAS# | 21041-10-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | COC1=CC=C2C3=C1O[C@](C4)([H])[C@@]3(CCN(C)C2)CCC4=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11259.html |
| Additional Information | NULL |