Ruxolitinib
API Standards
| Trivial name | NULL |
| Catalog Number | CS-T-61211 |
| Alternative Name(s) | (R)--Cyclopentyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1H-pyrazole-1-propanenitrile; INCB 018424; (R)-Ruxolitinib. |
| Research Area | Ruxolitinib is a selective Janus tyrosine kinase (JAK1 and JAK2) inhibitor used in the treatment of myeloproliferative neoplasms and psoriasis. |
| Molecular Formula | C17H18N6 |
| CAS# | 941678-49-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | N#CC[C@H](C1CCCC1)N2C=C(C3=C(C=CN4)C4=NC=N3)C=N2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST61211.html |
| Additional Information | NULL |