Amiodarone
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-07160 |
| Alternative Name(s) | (2-Butylbenzofuran-3-yl)[4-[2-(diethylamino)ethoxy]-3-iodophenyl]methanone hydrchloride; |
| Research Area | Amiodarone is an antianginal and class III antiarrhythmic drug. It increases the duration of ventricular and atrial muscle action by inhibiting POTASSIUM CHANNELS and VOLTAGE-GATED SODIUM CHANNELS. There is a resulting decrease in heart rate and in vascul |
| Molecular Formula | C25H29I2NO3Cl |
| CAS# | 1951-25-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C1=CC=C(OCCN(CC)CC)C=C1)C(C(C=CC=C2)=C2O3)=C3CCCC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO07160.html |
| Additional Information | NULL |