Gestodene D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06645 |
| Alternative Name(s) | (1S,2R,10R,11S,14R,15S)‐15‐ethyl‐14‐ethynyl‐14‐ hydroxy(2,4,4,6,8,8‐ D6)te9;]hept208; dien‐5‐one |
| Research Area | Labeled Gestodene, intended for use as an internal standard for the quantification of Gestodene by GC- or LC-mass spectrometry. |
| Molecular Formula | C21H20D6O2 |
| CAS# | 1542211-40-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC[C@@]1([C@]2(O)C#C)[C@](C=C2)([H])[C@@](CC([2H])([2H])C3=C4[2H])([H])[C@]([C@@]3([2H])CC([2H])([2H])C4=O)([H])CC1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06645.html |
| Additional Information | NULL |