Cefditoren 13C D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02870 |
| Alternative Name(s) | (6R)-7-[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(Z)-2-(4-methyl-1,3-thiazol-5-yl)ethenyl]-8-oxo-5-thia-1-az2-ene-2-carboxylic acid |
| Research Area | Labeled Cefditoren, intended for use as an internal standard for the quantification of Cefditoren by GC- or LC-mass spectrometry. |
| Molecular Formula | C18[13C]H15D3N6O5S3 |
| CAS# | 104145-95-1 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C(N1[C@@]2([H])[C@H](NC(/C(C3=CSC(N)=N3)=NO[13C]([2H])([2H])[2H])=O)C1=O)=C(CS2)/C=CC(SC=N4)=C4C)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02870.html |
| Additional Information | NULL |