Hesperetin 3-O-β-D-glucuronide
Glucuronides
| Trivial name | NULL |
| Catalog Number | CS-O-07853 |
| Alternative Name(s) | Hesperetin 3-O-β-D-glucuronide;(S)-5-(3,4-Dihydro-5,7-dihydroxy-4-oxo-2H-1-benzopyran-2-yl)-2-methoxyphenyl β-D-Glucopyranosiduronic Acid. |
| Research Area | Hesperetin 3-O-β-D-Glucuronide is one of the most abundant metabolite of Hesperetin (H289500) in vivo. |
| Molecular Formula | C22H22O12 |
| CAS# | 150985-66-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@H]([C@@H](O)[C@@H]1O)[C@@H](O[C@@H]1C(O)=O)OC(C=C([C@H](C2)OC3=CC(O)=CC(O)=C3C2=O)C=C4)=C4OC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO07853.html |
| Additional Information | NULL |