1,4-Dibromobutane D8
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-52511 |
| Alternative Name(s) | dibromo(²H₈)butane |
| Research Area | 1,4-Dibromobutane-d8 is used in studies pertaining to sulforaphane, a naturally occuring isothiocyanate present in broccoli that shows anti-carcinogenic activity. It is an analog of 1,4-Dibromobutane, a compund used as a catalyst in the polymerization of 2-oxazolines. |
| Molecular Formula | C4Br2D8 |
| CAS# | 68375-92-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | BrC([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])Br |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST52511.html |
| Additional Information | NULL |