Ondansetron Impurity D
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-31137 |
| Alternative Name(s) | Ondansetron Impurity D;9-Methyl-3-methylene-1,2,3,9-tetrahydro-4H-carbazol-4-one;CS-K-00098 |
| Research Area | 1,2,3,9-Tetrahydro-9-methyl-3-methylene-4H-carbazol-4-one is an impurity of Ondansetron .;Impurity in commercial preparations of Ondansetron |
| Molecular Formula | C14H13NO |
| CAS# | 99614-64-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(CC1)=C)C2=C1N(C)C3=CC=CC=C23 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO31137.html |
| Additional Information | NULL |