Montelukast EP Impurity C
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-10008 |
| Alternative Name(s) | 1-[[[1-[3-[2-l]-3-[2-(1-hydroxy-1-methylethyl)phenyl]propyl]sulfinyl]methc cid; Montelukast Sulfoxide; Montelukast USP Relatedcompound A; Montelukast S-Oxide |
| Research Area | Impurity in commercial preparations of Montelukast. It is also a metabolite of Montelukast. |
| Molecular Formula | C35H36ClNO4S |
| CAS# | 909849-96-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=S(CC1(CC(O)=O)CC1)C(CCC2=C(C(O)(C)C)C=CC=C2)C3=CC(/C=C/C4=NC5=C(C=C4)C=CC(Cl)=C5)=CC=C3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10008.html |
| Additional Information | NULL |