Alprazolam D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06395 |
| Alternative Name(s) | 12-chloro-3-methyl-9-[(2,3,4,5,6-2H5)phenyl]- 2,4,5,8-tetraazatricyclo[8.4.0.02,6]tetradeca- 1(14),3,5,8,10,12-hexaene |
| Research Area | Labeled Alprazolam, intended for use as an internal standard for the quantification of Alprazolam by GC- or LC-mass spectrometry. |
| Molecular Formula | C17HClD5N4 |
| CAS# | 125229-61-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1=NN=C2N1C3=CC=C(Cl)C=C3C(C(C([2H])=C4[2H])=C(C([2H])=C4[2H])[2H])=NC2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06395.html |
| Additional Information | NULL |