5-Oxo-L-proline D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-60040 |
| Alternative Name(s) | L-2-Pyrrolidinone-3,3,3,4,4,4-D5-carboxylic Acid;L-2-Pyrrolidinone-3,3,4,4,5-d5 Pyrrolidinonecarboxylic Acid-d5; L-Pyroglutamic acid-d5; 5-Oxo-DL-proline-d5; H-L-Pyr-OH-d5; 5-Oxo-L-proline-2,3,3,4,4-d5; |
| Research Area | 5-Oxo-L-proline-d5 is a labelled cyclized derivative of L-Glutamic Acid . The pyroglutamate core has potential application for synthesis of novel anti-bacterials. |
| Molecular Formula | C5H2D5NO3 |
| CAS# | 1086136-22-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC([C@@](C([2H])([2H])C1([2H])[2H])([2H])NC1=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST60040.html |
| Additional Information | NULL |