Ipratropium D3 Iodide
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06682 |
| Alternative Name(s) | (1R,5S)-3-[(3-hydroxy-2-phenylpropanoyl)oxy]-8-(D3)methyl-8-(propan-2-yl)-8-azabicyclo[3.2.1]octan-8-ium iodide |
| Research Area | Labeled Ipratropium, intended for use as an internal standard for the quantification of Ipratropium by GC- or LC-mass spectrometry. |
| Molecular Formula | C20H27D3INO3 |
| CAS# | 60205-80-3 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC([N@+]1([C@H]2C[C@H](OC(C(C3=CC=CC=C3)CO)=O)C[C@@H]1CC2)C([2H])([2H])[2H])C.[I-] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06682.html |
| Additional Information | NULL |