Imatinib D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02701 |
| Alternative Name(s) | NULL |
| Research Area | Labeled Imatinib, intended for use as an internal standard for the quantification of Imatinib by GC- or LC-mass spectrometry. |
| Molecular Formula | C29H27D4N7O |
| CAS# | 1134803-16-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1=CC=C(NC(C(C([2H])=C2[2H])=C(C([2H])=C2CN3CCN(C)CC3)[2H])=O)C=C1NC4=NC=CC(C5=CN=CC=C5)=N4 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02701.html |
| Additional Information | NULL |