Neostigmine methyl sulphate
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-30696 |
| Alternative Name(s) | 3-(N,N-Dimethylcarbamoyloxy)-N,N,N,-trimethylanilinium methyl sulfate |
| Research Area | Neostigmine methyl sulfate is a cholinesterase inhibitor used in the treatment of myasthenia gravis |
| Molecular Formula | C13H22N2O6S |
| CAS# | 51-60-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[N+](C)(C)C1=CC=CC(OC(N(C)C)=O)=C1.O=S(OC)([O-])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30696.html |
| Additional Information | NULL |