Taurodeoxycholic Acid-D4 Sodium Salt Hydrate
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-15356 |
| Alternative Name(s) | Taurodeoxycholic Acid-D4 Sodium Salt Hydrate |
| Research Area | Labeled Taurodeoxycholic Acid, intended for use as an internal standard for the quantification of Taurodeoxycholic Acid by GC- or LC-mass spectrometry. |
| Molecular Formula | C26H40D4NNaO7 |
| CAS# | 207737-97-1 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]1([C@@]2([H])[C@H](C)CCC(NCC[S](=O)(O)=O)=O)[C@](CC2)([H])[C@@](CC[C@@]3([H])[C@@]4(CC([2H])([2H])[C@@H](O)C3([2H])[2H])C)([H])[C@]4([H])C[C@@H]1O.[NaH].O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO15356.html |
| Additional Information | NULL |