Clotrimazole D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-13294 |
| Alternative Name(s) | 1-((2-chlorophenyl)(2,3,4,5,6-pentamethylphenyl)(phenyl)methyl)-1H-imidazole ;CS-P-07492 |
| Research Area | Labeled Clotrimazole, intended for use as an internal standard for the quantification of Clotrimazole by GC- or LC-mass spectrometry. |
| Molecular Formula | C22H12D5ClN2 |
| CAS# | 1185076-41-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClC1=C(C=CC=C1)C(C(C([2H])=C2[2H])=C(C([2H])=C2[2H])[2H])(C3=CC=CC=C3)N4C=CN=C4 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO13294.html |
| Additional Information | NULL |
