Vortioxetine D8
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-AA-00010 |
| Alternative Name(s) | 1-(2-(2,4-dimethylphenylthio)phenyl)piperazine-d8 ; Vortioxetine-d8;4‐{2‐[(2,4‐dimethylphenyl)sulfanyl]phenyl}(2,2,3,3,5,5,6,6‐ D8)piperidine. |
| Research Area | Labeled Vortioxetine, intended to use as an internal standard for the quantification of Vortioxetine by GC- or LC-mass spectrometry. |
| Molecular Formula | C18H14D8N2S |
| CAS# | 2140316-62-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1=C(C=CC(C)=C1)SC2=C(N3C([2H])([2H])C([2H])([2H])NC([2H])([2H])C3([2H])[2H])C=CC=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSAA00010.html |
| Additional Information | NULL |