Trazodone D6 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-07033 |
| Alternative Name(s) | 2-[3-[4-(3chlorophenyl)-1-piperazinyl]propyl-d6]-1,2,4-triazolo[4,3-a]pyridin-3(2H)-one Hydrchloride; |
| Research Area | Labeled Trazodone, intended for use as an internal standard for the quantification of Trazodone by GC- or LC-mass spectrometry. |
| Molecular Formula | C19H17DCl2N5O |
| CAS# | 1181578-71-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1N(C=CC=C2)C2=NN1C([2H])([2H])C([2H])([2H])C([2H])([2H])N3CCN(C4=CC(Cl)=CC=C4)CC3.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO07033.html |
| Additional Information | NULL |