Tobramycin
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-02441 |
| Alternative Name(s) | (2S,3R,4S,5S,6R)-4-amino-2-{[(1S,2S,3R,4S,6R)-4,6- diamino-3-{[(2R,3R,5S,6R)-3-amino-6-(aminomethyl)-5- hydroxyoxan-2-yl]oxy}-2-hydr)oxane-3,5-diol |
| Research Area | Tobramycin is an aminoglycoside, broad-spectrum antibiotic produced by Streptomyces tenebrarius. It is effective against gram-negative bacteria, especially the PSEUDOMONAS species. It is a 10% component of the antibiotic complex, NEBRAMYCIN, produced by t |
| Molecular Formula | C18H37N5O9 |
| CAS# | 32986-56-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@H]([C@@H]1O[C@@]([C@@H](C[C@@H]2O)N)([H])O[C@@H]2CN)[C@H]([C@@H](C[C@@H]1N)N)O[C@@]([C@@H]([C@@H](N)[C@@H]3O)O)([H])O[C@@H]3CO |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02441.html |
| Additional Information | NULL |