Levodopa D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02700 |
| Alternative Name(s) | Dopa-phenyl-d3;3-(3,4-Dihydroxyphenyl-2,5,6-d3)-L-alanine;L-DOPA-(ring-d3);L-Dihydroxyphenylalanine-D3;L-DOPA-2,5,6-d3. |
| Research Area | Labeled Levodopa, intended for use as an internal standard for the quantification of Levodopa by GC- or LC-mass spectrometry. |
| Molecular Formula | C9H8D3NO4 |
| CAS# | 53587-29-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | N[C@H](C(O)=O)CC(C([2H])=C1[2H])=C(C(O)=C1O)[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02700.html |
| Additional Information | NULL |