Bumetanide
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-00982 |
| Alternative Name(s) | 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoicacid |
| Research Area | Bumetanide is a sulfamyl diuretic. The physiologic effect of bumetanide is by means of Increased Diuresis at Loop of Henle |
| Molecular Formula | C17H20N2O5S |
| CAS# | 28395-03-01 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CCCCNC1=C(C(=CC(=C1)C(=O)O)S(=O)(=O)N)OC2=CC=CC=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00982.html |
| Additional Information | NULL |