Cephapirin benzathine
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-01213 |
| Alternative Name(s) | (6R,7R)-3-(acetoxymethyl)-8-oxo-7-(2-(pyridin-4-ylthio)acetamido)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Research Area | Cephapirin Benzathine is the benzathine salt form of cephapirin, a semisynthetic, broad-spectrum, first-generation cephalosporin with antibacterial activity |
| Molecular Formula | C50H54N8O12S4 |
| CAS# | 97468-37-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C(N1[C@@]2([H])[C@H](NC(CSC3=CC=NC=C3)=O)C1=O)=C(CS2)COC(C)=O)=O.OC(C(N4[C@@]5([H])[C@H](NC(CSC6=CC=NC=C6)=O)C4=O)=C(CS5)COC(C)=O)=O.C7(CNCCNCC8=CC=CC=C8)=CC=CC=C7 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01213.html |
| Additional Information | NULL |