Beclomethasone-17-Propionate D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-30468 |
| Alternative Name(s) | (11β,16β)17-(1-oxopropoxy-d5)-pregna-1,4-diene-3,20-dione;Monopropionate-d5 |
| Research Area | Active metabolite of Beclomethasone Dipropionate;Labeled Beclomethasone, intended for use as an internal standard for the quantification of Beclomethasone by GC- or LC-mass spectrometry. |
| Molecular Formula | C25H28DClO6 |
| CAS# | 5534-18-9 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C([2H])([2H])C([2H])([2H])[2H])O[C@@]([C@]([C@@]1([H])C2)(C[C@H](O)[C@](Cl)([C@]3(C=C4)C)[C@@]1([H])CCC3=CC4=O)C)([C@H]2C)C(CO)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30468.html |
| Additional Information | NULL |