Terbutaline D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06997 |
| Alternative Name(s) | 5-[2-(tert-butylamino)-1-hydroxy(1,2,2-D3)ethyl]benzene-1,3-diol |
| Research Area | Labeled Terbutaline, intended for use as an internal standard for the quantification of Terbutaline by GC- or LC-mass spectrometry. |
| Molecular Formula | C12H16D3NO3 |
| CAS# | 23031-25-6 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C1=CC(O)=CC(O)=C1)([2H])C([2H])([2H])NC(C)(C)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06997.html |
| Additional Information | NULL |