Entacapone D10
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06584 |
| Alternative Name(s) | (2Z)-2cyano-3-(3,4-dihydroxy-5-nitrophenyl)-N,N-diethyl-2-propenamide-d10; (Z)-Entcapone-d10; |
| Research Area | Labeled Entacapone, intended for use as an internal standard for the quantification of Entacapone by GC- or LC-mass spectrometry. |
| Molecular Formula | C14H5D10N3O5 |
| CAS# | 1185241-19-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N(C([2H])([2H])C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])[2H])/C(C#N)=C/C1=CC([N+]([O-])=O)=C(O)C(O)=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06584.html |
| Additional Information | NULL |