Oxaliplatin EP Impurity D
Impurities
| Trivial name | NULL |
| Catalog Number | CS-T-59979 |
| Alternative Name(s) | Oxaliplatin EP Impurity D;oxaliplatin Related Compound D;(S,S)-Oxaliplatin;(SP-4-2)-[(1S,2S)-cyclohexane-1,2-diamine-kN,kN][ethanedioato(2-)-kO1,kO2]platinum (S,S-enantiomer of oxaliplatin); |
| Research Area | The (S,S) Oxaliplatin isomer. Third generation platinum complex. An antitumor agent with activity against colorectal cancer. Cytotoxicity follows the formation of adducts with DNA. Antineoplastic. |
| Molecular Formula | C8H14N2O4Pt |
| CAS# | 61758-77-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1[O-][Pt+2]2([NH2][C@](CCCC3)([H])[C@@]3([H])[NH2]2)[O-]C1=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST59979.html |
| Additional Information | NULL |