2-NP-AOZ D4
Marine
| Trivial name | NULL |
| Catalog Number | CS-W-00155 |
| Alternative Name(s) | 3-[(E)-[(2-nitrophenyl)methylidene]amino](D4)-1,3- oxazolidin-2-one |
| Research Area | Labeled AOZ, intended for use as an internal standard for the quantification of AOZ by GC- or LC-mass spectrometry. |
| Molecular Formula | C10H5D4N3O4 |
| CAS# | 1007478-57-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1N(C([2H])([2H])C([2H])([2H])O1)/N=C/C(C=CC=C2)=C2[N](=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSW00155.html |
| Additional Information | NULL |
