Norgestimate D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-59729 |
| Alternative Name(s) | (17α)-17yl-18,19-dinorpregn-4-en-20-yn-3-one 3-Oxime-d6; Dexnorgestrel Acetime-d6; D-138-d6; ORF-10131-d6 |
| Research Area | Progestogen. In combination with estrogen as oral contraceptive. Intended for use as an internal standard for the quantification of Norgestimate by GC- or LC-mass spectrometry. |
| Molecular Formula | C23H25D6NO3 |
| CAS# | 1263194-12-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC[C@]1([C@]2([H])[C@@](CC([2H])([2H])C3=C4[2H])([H])[C@]([C@@]3([2H])CC([2H])([2H])C4=NO)([H])CC1)[C@](C#C)(CC2)OC(C)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST59729.html |
| Additional Information | NULL |