Erlotinib
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-31362 |
| Alternative Name(s) | Tarceva; N-(3-Ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine |
| Research Area | Erlotinib is a tyrosine kinase inhibitor which acts on the epidermal growth factor receptor (EGFR), inhibiting EGFR-associated kinase activity (IC50 = 2.5 µM).1,2 This inhibits tumor growth in human head and neck carcinoma (HN5) tumor xenografts in mice w |
| Molecular Formula | C22H23N3O4 |
| CAS# | 183321-74-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C#CC1=CC=CC(NC2=NC=NC3=C2C=C(OCCOC)C(OCCOC)=C3)=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO31362.html |
| Additional Information | NULL |