N-Nitrosodimethylamine D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-59622 |
| Alternative Name(s) | N-Nitrosodi-N-methylamine-d6; Dimethylnitrosamine-d6; NDMA-d6; NSC 23226-d6; |
| Research Area | A labelled highly toxic semi-volatile organic compound and a suspected human carcinogen. It induces liver tumors in rats after chronic exposure to low doses. |
| Molecular Formula | C2D6N2O |
| CAS# | 17829-05-09 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [2H]C([2H])([2H])N(N=O)C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST59622.html |
| Additional Information | NULL |