Gestodene
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-30926 |
| Alternative Name(s) | Gestodenum;Gestodeno;(8R,9S,10R,13S,14S,17R)-13-ethyl-17-ethynyl-17-hydroxy-6,7,8,9,10,11,12,13,14,17en-3(2H)-one;Gestoden; Gestodenum; Gestodeno; Gestodenum [INN-Latin];18,19-Dinorpregna-4,15-dien-20-yn-3-one, 13-ethyl-17-hydroxy-, (17-alpha);DSST_RID_81649;DSSTox_GSID_46478 |
| Research Area | Orally active gestogen with progesterone-like profile of activity. Used in combination with estrogen as oral contraceptive. |
| Molecular Formula | C21H26O2 |
| CAS# | 60282-87-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC[C@@]1([C@]2(O)C#C)[C@](C=C2)([H])[C@@](CCC3=CC4=O)([H])[C@]([C@@]3([H])CC4)([H])CC1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30926.html |
| Additional Information | NULL |