Felbamate
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-30925 |
| Alternative Name(s) | 3-(carbamoyloxy)-2-phenylpropyl carbamate |
| Research Area | Felbamate is an Anti-epileptic Agent. The physiologic effect of felbamate is by means of Decreased Central Nervous System Disorganized Electrical Activity. |
| Molecular Formula | C11H14N2O4 |
| CAS# | 25451-15-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC(OCC(C1=CC=CC=C1)COC(N)=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30925.html |
| Additional Information | NULL |