Lumefantrine D9
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06739 |
| Alternative Name(s) | NULL |
| Research Area | Labeled Lumefantrine, intended for use as an internal standard for the quantification of Lumefantrine by GC- or LC-mass spectrometry. |
| Molecular Formula | C30H23D9Cl3NO |
| CAS# | 82186-77-4 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C1=CC(Cl)=CC2=C1C3=CC=C(Cl)C=C3/C2=C/C4=CC=C(Cl)C=C4)CN(C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])CCCC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06739.html |
| Additional Information | NULL |