Metaxalone D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06760 |
| Alternative Name(s) | 5‐[dimethyl(D3)phenoxymethyl]‐1,3‐oxazolidin‐2‐ one. |
| Research Area | Labeled Metaxalone, intended for use as an internal standard for the quantification of Metaxalone by GC- or LC-mass spectrometry. |
| Molecular Formula | C12H12D3NO3 |
| CAS# | 1192812-66-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1OC(CN1)COC(C([2H])=C(C)C([2H])=C2C)=C2[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06760.html |
| Additional Information | NULL |