Metronidazole D4 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06773 |
| Alternative Name(s) | 2-(2-methyl-5-nitro-1H-imidazol-1-yl)(²H4)ethan-1-ol hydrochloride |
| Research Area | Labeled Ronidazole, intended for use as an internal standard for the quantification of Ronidazole by GC- or LC-mass spectrometry. |
| Molecular Formula | C6D4H5N3O3.HCl |
| CAS# | 1261397-74-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC([2H])([2H])C([2H])([2H])N1C([N](=O)=O)=CN=C1C.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06773.html |
| Additional Information | NULL |