Misoprostol Acid
Metabolites
| Trivial name | NULL |
| Catalog Number | CS-O-00767 |
| Alternative Name(s) | (11a,13E)-11,16-Dihydroxy-16-methyl-9-oxo-prost-13-en-1/-)-15-Deoxy-(16RS)-16-hydroxy-16-methylprogestaglandin E1; |
| Research Area | A metabolite of Misoprostol. Cytoprotective PGE1 analog that prevents NSAID-induced gastric ulceration. |
| Molecular Formula | C21H36O5 |
| CAS# | 112137-89-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1[C@@H]([C@H]([C@H](O)C1)/C=C/CC(C)(O)CCCC)CCCCCCC(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00767.html |
| Additional Information | NULL |