Sulfamethoxazole 13C6
Marine
| Trivial name | NULL |
| Catalog Number | CS-O-00762 |
| Alternative Name(s) | 4-amino-N-(5-methyl-1,2-oxazol-3-yl)(1,2,3,4,5,6-fonamide; 4-Amino-N-(5-methyl-3-isoxazolyl)benzenesulfonamide-13C6 |
| Research Area | Labeled Sulfamethoxazole, intended for use as an internal standard for the quantification of Sulfamethoxazole by GC- or LC-mass spectrometry. |
| Molecular Formula | C4(1C)6H11N3O3S |
| CAS# | 1196157-90-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[S](NC1=NOC(C)=C1)([13C]2=[13CH][13CH]=[13C](N)[13CH]=[13CH]2)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00762.html |
| Additional Information | NULL |