6-Mercaptopurine-13C2 15N
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02871 |
| Alternative Name(s) | 1,9-Dihydro-6H-purine ; CS-P-02949 |
| Research Area | Labeled 6-Mercaptopurine, intended for use as an internal standard for the quantification of 6-Mercaptopurine by GC- or LC-mass spectrometry. |
| Molecular Formula | C31C2H4N315NS |
| CAS# | 1190008-04-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | S=C1C([15NH][13CH]=N2)=[13C]2NC=N1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02871.html |
| Additional Information | NULL |