Creatinine D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06509 |
| Alternative Name(s) | 2-amino-1-(²H3)methyl-4,5-dihydro-1H-imidazol-4-one |
| Research Area | Labeled Creatinine, intended for use as an internal standard for the quantification of Creatinine by GC- or LC-mass spectrometry. |
| Molecular Formula | C4H4D3N3O |
| CAS# | 143827-20-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC(N(C1)C([2H])([2H])[2H])=NC1=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06509.html |
| Additional Information | NULL |