Elvitegravir D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03037 |
| Alternative Name(s) | 6-[(3-chloro-2-fluorophenyl)methyl]-1-[(2S)-1-hydroxy-3-methyl(1,1-D2)butan-2-yl]-7-(D3)methoxy-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| Research Area | Labeled Elvitegravir, intended for use as an internal standard for the quantification of Elvitegravir by GC- or LC-mass spectrometry. |
| Molecular Formula | C23H18D5ClFNO5 |
| CAS# | 1131640-69-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(C)[C@H](N(C=C1C(O)=O)C2=CC(OC([2H])([2H])[2H])=C(CC(C=CC=C3Cl)=C3F)C=C2C1=O)C([2H])([2H])O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03037.html |
| Additional Information | NULL |