5-trans-Travoprost
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-08358 |
| Alternative Name(s) | 5-trans-Travoprost;5,6-trans Fluprostenol isopropyl ester;5-trans Fluprostenol isopropyl ester;5,6-trans Travoprosttion markA)-16-(m-Trifluoromethylphenoxy)tetranorprostaglandin F2; (5E)-7-[(1R,3R,3R,5S)-3,5-dihydroxy-2-[(1E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]-1-buten-1-eptenoc cid 1-Methylethyl Ester; |
| Research Area | An 5,6-trans isomeric impurity of the selective FP prostaglandin receptor agonist Travoprost (T715600).;Impurity in commercial preparations of Travoprost |
| Molecular Formula | C26H35F3O6 |
| CAS# | 1563176-59-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@H]1[C@@H]([C@H]([C@H](O)C1)/C=C/[C@@H](O)COC2=CC(C(F)(F)F)=CC=C2)C/C=C/CCCC(OC(C)C)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO08358.html |
| Additional Information | NULL |