Darunavir Ethanolate
Inhibitors
| Trivial name | NULL |
| Catalog Number | CS-O-00287 |
| Alternative Name(s) | N-[(1S,2R)-3-[[(4-aminophenyl)sulfonyl](2-methylpropyl)amino]-2-hydroxy-1-(phenylmethyl)proprofuro[2,3-b]furan-3-yl Estnol;hexahydrofuro[2,3-b]furan-3-yl (4-(4-amino-N-isobutylphenylsulfonamido)-3-hydroxy-1-phenylbutan-2-ylcarbamatecompound with ethanol (1:1). |
| Research Area | Darunavir Ethanolate (Prezista) is an HIV protease inhibitor. Derivative of Darunavir , a second generation HIV-1-protease inhibitor; structurally similar to amprenavir. Antiviral. |
| Molecular Formula | C29H43N3O8S |
| CAS# | 635728-49-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CCO.O=C(N[C@@H](CC1=CC=CC=C1)[C@H](O)CN(CC(C)C)[S](=O)(C2=CC=C(N)C=C2)=O)O[C@@H]3[C@@](CCO4)([H])[C@@]4([H])OC3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00287.html |
| Additional Information | NULL |