Tadalafil EP Impurity A
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-08227 |
| Alternative Name(s) | (6R,12aS)-6-(1,3-Benzodioxol-5-yl)-2,3,6,7,12,12a-hexahydro-2-methylpyrazino[1',2':1,6]pyrido[3,4-b]indole-1,4-dione; (,6,7,12,12a- hexahydro-2-methylpyrazino[1',2':1,6]pyrido[3,4-b]indole-1,4-dione; |
| Research Area | The (6R)-cis-enantiomer of Tadalafil;Impurity in commercial preparations of Tadalafil |
| Molecular Formula | C22H19N3O4 |
| CAS# | 171596-27-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N1[C@@H](C2=C(C[C@]1(C3=O)[H])C4=CC=CC=C4N2)C5=CC6=C(C=C5)OCO6)CN3C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO08227.html |
| Additional Information | NULL |