Clindamycin D3 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03090 |
| Alternative Name(s) | NULL |
| Research Area | Labelled Clindamycin. Semi-synthetic antibiotic prepared from Lincomycin;Labeled Clindamycin, intended for use as an internal standard for the quantification of Clindamycin by GC- or LC-mass spectrometry. |
| Molecular Formula | C18H31DCl2N2O5S |
| CAS# | 1356933-72-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@H](Cl)[C@@]([C@@]([C@@H]([C@H](O)[C@H]1O)O)([H])O[C@@H]1SC)([H])NC([C@@H]2C[C@@H](CCC)CN2C([2H])([2H])[2H])=O.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03090.html |
| Additional Information | NULL |