4-Hydroxy propranolol Hydrochloride D7
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02659 |
| Alternative Name(s) | (�)4-Hydroxy propropranolol-d7;4-(2-hydroxy-3-{[(D7)propan-2-yl]amino}propoxy)naphthalen-1-ol hydrochloride;CS-Y-00128;CS-P-02880 |
| Research Area | Labeled Propranolol, intended for use as an internal standard for the quantification of Propranolol by GC- or LC-mass spectrometry. |
| Molecular Formula | C16H15D7ClNO3 |
| CAS# | 1219804-03-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(CNC(C([2H])([2H])[2H])([2H])C([2H])([2H])[2H])COC1=CC=C(O)C2=C1C=CC=C2.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02659.html |
| Additional Information | NULL |