Flecainide D4 acetate
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06625 |
| Alternative Name(s) | N-(piperidin-2-ylmethyl)-2,5- bis[trifluoro(²H2)ethoxy]benzamide; cetc cid |
| Research Area | Labeled Flecainide, intended for use as an internal standard for the quantification of Flecainide by GC- or LC-mass spectrometry. |
| Molecular Formula | C19H20D4F6N2O5 |
| CAS# | 1276197-21-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(O)=O.O=C(C(C=C(OC([2H])([2H])C(F)(F)F)C=C1)=C1OC([2H])([2H])C(F)(F)F)NCC2CCCCN2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06625.html |
| Additional Information | NULL |