Dansyl Chloride D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-51590 |
| Alternative Name(s) | 5-[(²H₃)methyl(methyl)amino](2,3,4-²H₃)naphthalene-1-sulfonyl chloride |
| Research Area | Labelled Dansyl Chloride . Reagent for fluorescent labelling of amines, amino acids and proteins. |
| Molecular Formula | C12H6D6ClNO2S |
| CAS# | 1276379-68-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | Cl[S](=O)(C1=CC=CC2=C1C=CC=C2N(C([2H])([2H])[2H])C([2H])([2H])[2H])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST51590.html |
| Additional Information | NULL |