Dabigatran Etexilate N-Oxide
Metabolites
| Trivial name | NULL |
| Catalog Number | CS-O-11171 |
| Alternative Name(s) | Impurity N;N-[[2-[[[4-[[[(Hexylo]amino]methyl]-1-methyl-1H-benzimidazol-5-xido-2-pyridinyl)-β-Alanine Ethyl Ester |
| Research Area | Dabigatran Etexilate N-Oxide is a metabolite of Dabigatran Etexilate, an oral anticoagulant and direct thrombin inhibitor. |
| Molecular Formula | C34H41N7O6 |
| CAS# | 1381757-44-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN1C2=CC=C(C(N(C3=CC=CC=[N]3=O)CCC(OCC)=O)=O)C=C2N=C1CNC4=CC=C(C(NC(OCCCCCC)=O)=N)C=C4 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11171.html |
| Additional Information | NULL |